C15H13N3O2 — CID 43586464
6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione (PubChem CID 43586464) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione.
| Compound Name | 6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 43586464 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione |
| SMILES | CN(Cc1cccnc1)c1ccc2c(c1)NC(=O)C2=O |
| InChI | InChI=1S/C15H13N3O2/c1-18(9-10-3-2-6-16-8-10)11-4-5-12-13(7-11)17-15(20)14(12)19/h2-8H,9H2,1H3,(H,17,19,20) |
| InChIKey | PUGNXXPOAOVCQI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|