C15H12ClN3O2 — CID 79342515
5-chloro-6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione (PubChem CID 79342515) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is 5-chloro-6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione.
| Compound Name | 5-chloro-6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 79342515 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-chloro-6-[methyl(pyridin-3-ylmethyl)amino]-1H-indole-2,3-dione |
| SMILES | CN(Cc1cccnc1)c1cc2c(cc1Cl)C(=O)C(=O)N2 |
| InChI | InChI=1S/C15H12ClN3O2/c1-19(8-9-3-2-4-17-7-9)13-6-12-10(5-11(13)16)14(20)15(21)18-12/h2-7H,8H2,1H3,(H,18,20,21) |
| InChIKey | JXKDIBGHPDCJRS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|