C18H32N2O — CID 43588416
N-[3-[4-(aminomethyl)phenoxy]propyl]-N,2-diethylbutan-1-amine (PubChem CID 43588416) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[3-[4-(aminomethyl)phenoxy]propyl]-N,2-diethylbutan-1-amine.
| Compound Name | N-[3-[4-(aminomethyl)phenoxy]propyl]-N,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 43588416 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[3-[4-(aminomethyl)phenoxy]propyl]-N,2-diethylbutan-1-amine |
| SMILES | CCC(CC)CN(CC)CCCOc1ccc(CN)cc1 |
| InChI | InChI=1S/C18H32N2O/c1-4-16(5-2)15-20(6-3)12-7-13-21-18-10-8-17(14-19)9-11-18/h8-11,16H,4-7,12-15,19H2,1-3H3 |
| InChIKey | CPCOAYLUBGGAHW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|