C23H42N2O — CID 46890082
8-[4-(diethylaminomethyl)phenoxy]-N,N-diethyloctan-1-amine (PubChem CID 46890082) has the molecular formula C23H42N2O and a molecular weight of 362.60 g/mol. Its IUPAC name is 8-[4-(diethylaminomethyl)phenoxy]-N,N-diethyloctan-1-amine.
| Compound Name | 8-[4-(diethylaminomethyl)phenoxy]-N,N-diethyloctan-1-amine |
|---|---|
| PubChem CID | 46890082 |
| Molecular Formula | C23H42N2O |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.33 |
| IUPAC Name | 8-[4-(diethylaminomethyl)phenoxy]-N,N-diethyloctan-1-amine |
| SMILES | CCN(CC)CCCCCCCCOc1ccc(CN(CC)CC)cc1 |
| InChI | InChI=1S/C23H42N2O/c1-5-24(6-2)19-13-11-9-10-12-14-20-26-23-17-15-22(16-18-23)21-25(7-3)8-4/h15-18H,5-14,19-21H2,1-4H3 |
| InChIKey | GYCQGSQJICZJAE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|