C13H28N2O2 — CID 43588483
2-(aminomethyl)-N,N-bis(2-methoxyethyl)cyclohexan-1-amine (PubChem CID 43588483) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cyclohexan-1-amine.
| Compound Name | 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43588483 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-(aminomethyl)-N,N-bis(2-methoxyethyl)cyclohexan-1-amine |
| SMILES | COCCN(CCOC)C1CCCCC1CN |
| InChI | InChI=1S/C13H28N2O2/c1-16-9-7-15(8-10-17-2)13-6-4-3-5-12(13)11-14/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | UCTNGFFUORETFA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |