C10H19NO5S — CID 43592598
4-(2,2-dimethylmorpholin-4-yl)sulfonylbutanoic acid (PubChem CID 43592598) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(2,2-dimethylmorpholin-4-yl)sulfonylbutanoic acid.
| Compound Name | 4-(2,2-dimethylmorpholin-4-yl)sulfonylbutanoic acid |
|---|---|
| PubChem CID | 43592598 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(2,2-dimethylmorpholin-4-yl)sulfonylbutanoic acid |
| SMILES | CC1(C)CN(S(=O)(=O)CCCC(=O)O)CCO1 |
| InChI | InChI=1S/C10H19NO5S/c1-10(2)8-11(5-6-16-10)17(14,15)7-3-4-9(12)13/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | RCQHEOYXVHYEKF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |