C9H17NO5S — CID 43592599
3-(2,2-dimethylmorpholin-4-yl)sulfonylpropanoic acid (PubChem CID 43592599) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-(2,2-dimethylmorpholin-4-yl)sulfonylpropanoic acid.
| Compound Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 43592599 |
| Molecular Formula | C9H17NO5S |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-(2,2-dimethylmorpholin-4-yl)sulfonylpropanoic acid |
| SMILES | CC1(C)CN(S(=O)(=O)CCC(=O)O)CCO1 |
| InChI | InChI=1S/C9H17NO5S/c1-9(2)7-10(4-5-15-9)16(13,14)6-3-8(11)12/h3-7H2,1-2H3,(H,11,12) |
| InChIKey | VENLRIBDXHDOHO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |