C13H16FNO2 — CID 43592967
2-(2,2-dimethylmorpholin-4-yl)-5-fluorobenzaldehyde (PubChem CID 43592967) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-5-fluorobenzaldehyde.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 43592967 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-5-fluorobenzaldehyde |
| SMILES | CC1(C)CN(c2ccc(F)cc2C=O)CCO1 |
| InChI | InChI=1S/C13H16FNO2/c1-13(2)9-15(5-6-17-13)12-4-3-11(14)7-10(12)8-16/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | BHBMXFGZFZUKAM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|