C13H16ClNO — CID 114844443
5-chloro-2-(3,3-dimethylpyrrolidin-1-yl)benzaldehyde (PubChem CID 114844443) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 5-chloro-2-(3,3-dimethylpyrrolidin-1-yl)benzaldehyde.
| Compound Name | 5-chloro-2-(3,3-dimethylpyrrolidin-1-yl)benzaldehyde |
|---|---|
| PubChem CID | 114844443 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 5-chloro-2-(3,3-dimethylpyrrolidin-1-yl)benzaldehyde |
| SMILES | CC1(C)CCN(c2ccc(Cl)cc2C=O)C1 |
| InChI | InChI=1S/C13H16ClNO/c1-13(2)5-6-15(9-13)12-4-3-11(14)7-10(12)8-16/h3-4,7-8H,5-6,9H2,1-2H3 |
| InChIKey | CWUFVMVMCDWAHP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|