C11H12ClNO2S — CID 114844105
5-chloro-2-(1-oxo-1,4-thiazinan-4-yl)benzaldehyde (PubChem CID 114844105) has the molecular formula C11H12ClNO2S and a molecular weight of 257.74 g/mol. Its IUPAC name is 5-chloro-2-(1-oxo-1,4-thiazinan-4-yl)benzaldehyde.
| Compound Name | 5-chloro-2-(1-oxo-1,4-thiazinan-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 114844105 |
| Molecular Formula | C11H12ClNO2S |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 5-chloro-2-(1-oxo-1,4-thiazinan-4-yl)benzaldehyde |
| SMILES | O=Cc1cc(Cl)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H12ClNO2S/c12-10-1-2-11(9(7-10)8-14)13-3-5-16(15)6-4-13/h1-2,7-8H,3-6H2 |
| InChIKey | TUAFBSGMWUVGQT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|