C14H21ClN2OS — CID 114861183
1-[4-chloro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]butan-2-amine (PubChem CID 114861183) has the molecular formula C14H21ClN2OS and a molecular weight of 300.86 g/mol. Its IUPAC name is 1-[4-chloro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]butan-2-amine.
| Compound Name | 1-[4-chloro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 114861183 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.86 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[4-chloro-2-(1-oxo-1,4-thiazinan-4-yl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Cl)cc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-2-13(16)9-11-3-4-12(15)10-14(11)17-5-7-19(18)8-6-17/h3-4,10,13H,2,5-9,16H2,1H3 |
| InChIKey | ANRALBNAWIZTHR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.86 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |