C14H17N3O2S2 — CID 43593428
2,4-dimethyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzenesulfonamide (PubChem CID 43593428) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2,4-dimethyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43593428 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2,4-dimethyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3c(s2)CNCC3)c(C)c1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-9-3-4-13(10(2)7-9)21(18,19)17-14-16-11-5-6-15-8-12(11)20-14/h3-4,7,15H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | MEPYPUCLNJVPSA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |