C15H17N3O3S2 — CID 90625598
2,4-dimethyl-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzenesulfonamide (PubChem CID 90625598) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2,4-dimethyl-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 90625598 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2,4-dimethyl-N-(4-oxo-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-c]azepin-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2nc3c(s2)C(=O)NCCC3)c(C)c1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-9-5-6-12(10(2)8-9)23(20,21)18-15-17-11-4-3-7-16-14(19)13(11)22-15/h5-6,8H,3-4,7H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | MWAKUYFJIFESMJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |