C11H13N3O3S2 — CID 43593536
N-[(3-aminophenyl)methyl]-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 43593536) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[(3-aminophenyl)methyl]-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43593536 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCc1cccc(N)c1 |
| InChI | InChI=1S/C11H13N3O3S2/c1-7-10(18-11(15)14-7)19(16,17)13-6-8-3-2-4-9(12)5-8/h2-5,13H,6,12H2,1H3,(H,14,15) |
| InChIKey | MJDQELOKGXHKNQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|