C11H12N2O3S2 — CID 60716003
N-benzyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60716003) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-benzyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | N-benzyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 60716003 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-benzyl-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H12N2O3S2/c1-8-10(17-11(14)13-8)18(15,16)12-7-9-5-3-2-4-6-9/h2-6,12H,7H2,1H3,(H,13,14) |
| InChIKey | JGHKSRJBWHDOAQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |