C13H18N4O3 — CID 43595251
N-(5-azaspiro[3.5]nonan-8-yl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 43595251) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(5-azaspiro[3.5]nonan-8-yl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(5-azaspiro[3.5]nonan-8-yl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 43595251 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(5-azaspiro[3.5]nonan-8-yl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NC1CCNC2(CCC2)C1)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H18N4O3/c18-10-6-9(16-12(20)17-10)11(19)15-8-2-5-14-13(7-8)3-1-4-13/h6,8,14H,1-5,7H2,(H,15,19)(H2,16,17,18,20) |
| InChIKey | STLLUWZFQDATBH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |