C12H16N2O4S — CID 43597111
methyl 4-[(2-aminocyclopropyl)sulfamoylmethyl]benzoate (PubChem CID 43597111) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 4-[(2-aminocyclopropyl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[(2-aminocyclopropyl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 43597111 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 4-[(2-aminocyclopropyl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)NC2CC2N)cc1 |
| InChI | InChI=1S/C12H16N2O4S/c1-18-12(15)9-4-2-8(3-5-9)7-19(16,17)14-11-6-10(11)13/h2-5,10-11,14H,6-7,13H2,1H3 |
| InChIKey | NUGNAEPPBSYONN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |