About N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine
N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine (PubChem CID 43599624) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine |
| PubChem CID | 43599624 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine |
| SMILES | c1ccc2nc(NCCCNC3CC3)ccc2c1 |
| InChI | InChI=1S/C15H19N3/c1-2-5-14-12(4-1)6-9-15(18-14)17-11-3-10-16-13-7-8-13/h1-2,4-6,9,13,16H,3,7-8,10-11H2,(H,17,18) |
| InChIKey | VUBCVUDCGASLJI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine?
The IUPAC name of N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine (CID 43599624) is N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine.
What is the SMILES notation for N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine?
The canonical SMILES for N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine is c1ccc2nc(NCCCNC3CC3)ccc2c1.
What is the InChIKey of N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine?
The InChIKey is VUBCVUDCGASLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-2-5-14-12(4-1)6-9-15(18-14)17-11-3-10-16-13-7-8-13/h1-2,4-6,9,13,16H,3,7-8,10-11H2,(H,17,18).
What are the key properties of N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine?
N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine has a molecular weight of 241.34 g/mol, XLogP of 2.79, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-quinolin-2-ylpropane-1,3-diamine is sourced from PubChem (CID 43599624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).