C14H21N3O3S — CID 43600587
1,1-dioxo-N-[3-(pyridin-3-ylmethylamino)propyl]thiolane-3-carboxamide (PubChem CID 43600587) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1,1-dioxo-N-[3-(pyridin-3-ylmethylamino)propyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[3-(pyridin-3-ylmethylamino)propyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 43600587 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1,1-dioxo-N-[3-(pyridin-3-ylmethylamino)propyl]thiolane-3-carboxamide |
| SMILES | O=C(NCCCNCc1cccnc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21N3O3S/c18-14(13-4-8-21(19,20)11-13)17-7-2-6-16-10-12-3-1-5-15-9-12/h1,3,5,9,13,16H,2,4,6-8,10-11H2,(H,17,18) |
| InChIKey | VPWQNXOXPKACJU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|