C17H28ClN3O — CID 86779908
3-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 86779908) has the molecular formula C17H28ClN3O and a molecular weight of 325.88 g/mol. Its IUPAC name is 3-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 86779908 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 3-methyl-N-[3-(pyridin-3-ylmethylamino)propyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC1CCCC(C(=O)NCCCNCc2cccnc2)C1.Cl |
| InChI | InChI=1S/C17H27N3O.ClH/c1-14-5-2-7-16(11-14)17(21)20-10-4-9-19-13-15-6-3-8-18-12-15;/h3,6,8,12,14,16,19H,2,4-5,7,9-11,13H2,1H3,(H,20,21);1H |
| InChIKey | QYZRUCBBKUSBCZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|