C15H22N2O2S — CID 43602919
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-phenylmethanesulfonamide (PubChem CID 43602919) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 43602919 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NC1CC[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H22N2O2S/c18-20(19,11-12-4-2-1-3-5-12)17-15-7-6-13-9-16-10-14(13)8-15/h1-5,13-17H,6-11H2/t13-,14+,15?/m0/s1 |
| InChIKey | FELOLTNVVMJCMS-SNTRVMSOSA-N |
| XLogP | 1.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |