C23H33N3O6S — CID 59985556
(3S,4aR,6S,8aR)-6-[[(2S,4S)-4-(benzylsulfonylamino)-2-carboxypyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 59985556) has the molecular formula C23H33N3O6S and a molecular weight of 479.60 g/mol. Its IUPAC name is (3S,4aR,6S,8aR)-6-[[(2S,4S)-4-(benzylsulfonylamino)-2-carboxypyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (3S,4aR,6S,8aR)-6-[[(2S,4S)-4-(benzylsulfonylamino)-2-carboxypyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 59985556 |
| Molecular Formula | C23H33N3O6S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (3S,4aR,6S,8aR)-6-[[(2S,4S)-4-(benzylsulfonylamino)-2-carboxypyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2C[C@@H](CN3C[C@@H](NS(=O)(=O)Cc4ccccc4)C[C@H]3C(=O)O)CC[C@H]2CN1 |
| InChI | InChI=1S/C23H33N3O6S/c27-22(28)20-9-18-8-16(6-7-17(18)11-24-20)12-26-13-19(10-21(26)23(29)30)25-33(31,32)14-15-4-2-1-3-5-15/h1-5,16-21,24-25H,6-14H2,(H,27,28)(H,29,30)/t16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | QTHIRRDMKICONB-DGGDGUMWSA-N |
| XLogP | 1.11 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |