C23H30N6O4 — CID 22570650
6-[[2-carboxy-4-(5-phenyltetrazol-2-yl)pyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 22570650) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 6-[[2-carboxy-4-(5-phenyltetrazol-2-yl)pyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | 6-[[2-carboxy-4-(5-phenyltetrazol-2-yl)pyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22570650 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 6-[[2-carboxy-4-(5-phenyltetrazol-2-yl)pyrrolidin-1-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1CC2CC(CN3CC(n4nnc(-c5ccccc5)n4)CC3C(=O)O)CCC2CN1 |
| InChI | InChI=1S/C23H30N6O4/c30-22(31)19-9-17-8-14(6-7-16(17)11-24-19)12-28-13-18(10-20(28)23(32)33)29-26-21(25-27-29)15-4-2-1-3-5-15/h1-5,14,16-20,24H,6-13H2,(H,30,31)(H,32,33) |
| InChIKey | XDJFZPYOEZEIGR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |