C22H23N5O3 — CID 175641641
2-(1,3-benzodioxol-5-yl)-N-[4-(5-phenyltetrazol-2-yl)cyclohexyl]acetamide (PubChem CID 175641641) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(5-phenyltetrazol-2-yl)cyclohexyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(5-phenyltetrazol-2-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 175641641 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(5-phenyltetrazol-2-yl)cyclohexyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)NC1CCC(n2nnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H23N5O3/c28-21(13-15-6-11-19-20(12-15)30-14-29-19)23-17-7-9-18(10-8-17)27-25-22(24-26-27)16-4-2-1-3-5-16/h1-6,11-12,17-18H,7-10,13-14H2,(H,23,28) |
| InChIKey | KSSCCRNXJSQCNY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |