C20H28Cl4N6O2 — CID 70010456
(8aR)-6-[[(3,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;dihydrochloride (PubChem CID 70010456) has the molecular formula C20H28Cl4N6O2 and a molecular weight of 526.30 g/mol. Its IUPAC name is (8aR)-6-[[(3,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;dihydrochloride.
| Compound Name | (8aR)-6-[[(3,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 70010456 |
| Molecular Formula | C20H28Cl4N6O2 |
| Molecular Weight | 526.30 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | (8aR)-6-[[(3,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)C1CC2CC(CN(Cc3ccc(Cl)c(Cl)c3)Cc3nn[nH]n3)CC[C@H]2CN1 |
| InChI | InChI=1S/C20H26Cl2N6O2.2ClH/c21-16-4-2-13(6-17(16)22)10-28(11-19-24-26-27-25-19)9-12-1-3-14-8-23-18(20(29)30)7-15(14)5-12;;/h2,4,6,12,14-15,18,23H,1,3,5,7-11H2,(H,29,30)(H,24,25,26,27);2*1H/t12?,14-,15?,18?;;/m0../s1 |
| InChIKey | SBBCOXHZLKLTSO-OODIVXHKSA-N |
| XLogP | 3.83 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |