C18H31N3O4 — CID 142812314
6-[[2-acetamidooxyprop-2-enyl(ethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 142812314) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is 6-[[2-acetamidooxyprop-2-enyl(ethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | 6-[[2-acetamidooxyprop-2-enyl(ethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142812314 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 6-[[2-acetamidooxyprop-2-enyl(ethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | C=C(CN(CC)CC1CCC2CNC(C(=O)O)CC2C1)ONC(C)=O |
| InChI | InChI=1S/C18H31N3O4/c1-4-21(10-12(2)25-20-13(3)22)11-14-5-6-15-9-19-17(18(23)24)8-16(15)7-14/h14-17,19H,2,4-11H2,1,3H3,(H,20,22)(H,23,24) |
| InChIKey | HQJXEIKYEJGRMH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|