C20H26Cl2N6O2 — CID 70009892
(8aR)-6-[[(2,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 70009892) has the molecular formula C20H26Cl2N6O2 and a molecular weight of 453.37 g/mol. Its IUPAC name is (8aR)-6-[[(2,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (8aR)-6-[[(2,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70009892 |
| Molecular Formula | C20H26Cl2N6O2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (8aR)-6-[[(2,4-dichlorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1CC2CC(CN(Cc3nn[nH]n3)Cc3ccc(Cl)cc3Cl)CC[C@H]2CN1 |
| InChI | InChI=1S/C20H26Cl2N6O2/c21-16-4-3-14(17(22)7-16)10-28(11-19-24-26-27-25-19)9-12-1-2-13-8-23-18(20(29)30)6-15(13)5-12/h3-4,7,12-13,15,18,23H,1-2,5-6,8-11H2,(H,29,30)(H,24,25,26,27)/t12?,13-,15?,18?/m0/s1 |
| InChIKey | FBNKUFYIJFPDBU-GBXQIFIISA-N |
| XLogP | 2.99 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |