C17H20ClNO4S — CID 91310562
(3S,4aR,6S,8aR)-6-(2-carboxy-4-chlorophenyl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 91310562) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is (3S,4aR,6S,8aR)-6-(2-carboxy-4-chlorophenyl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (3S,4aR,6S,8aR)-6-(2-carboxy-4-chlorophenyl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 91310562 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (3S,4aR,6S,8aR)-6-(2-carboxy-4-chlorophenyl)sulfanyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1S[C@H]1CC[C@H]2CN[C@H](C(=O)O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H20ClNO4S/c18-11-2-4-15(13(7-11)16(20)21)24-12-3-1-9-8-19-14(17(22)23)6-10(9)5-12/h2,4,7,9-10,12,14,19H,1,3,5-6,8H2,(H,20,21)(H,22,23)/t9-,10-,12-,14-/m0/s1 |
| InChIKey | CSOIIZJOPHPJBD-WRZDFSGXSA-N |
| XLogP | 3.36 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |