C23H24N8O — CID 66915931
2-[4-[4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]piperazin-1-yl]benzonitrile (PubChem CID 66915931) has the molecular formula C23H24N8O and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[4-[4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 66915931 |
| Molecular Formula | C23H24N8O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[4-[4-(5-phenyltetrazol-2-yl)pyrrolidine-2-carbonyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(C(=O)C2CC(n3nnc(-c4ccccc4)n3)CN2)CC1 |
| InChI | InChI=1S/C23H24N8O/c24-15-18-8-4-5-9-21(18)29-10-12-30(13-11-29)23(32)20-14-19(16-25-20)31-27-22(26-28-31)17-6-2-1-3-7-17/h1-9,19-20,25H,10-14,16H2 |
| InChIKey | CFVJBJZLHKKDHZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |