C17H22N6O — CID 56816775
1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone (PubChem CID 56816775) has the molecular formula C17H22N6O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone.
| Compound Name | 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 56816775 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[4-(cyclopropylmethyl)piperazin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C17H22N6O/c24-16(22-10-8-21(9-11-22)12-14-6-7-14)13-23-19-17(18-20-23)15-4-2-1-3-5-15/h1-5,14H,6-13H2 |
| InChIKey | UEUBZIXPQCGZPL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |