C16H23ClN6O — CID 119397669
1-[3-(methylaminomethyl)piperidin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone;hydrochloride (PubChem CID 119397669) has the molecular formula C16H23ClN6O and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone;hydrochloride.
| Compound Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119397669 |
| Molecular Formula | C16H23ClN6O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-2-(5-phenyltetrazol-2-yl)ethanone;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)Cn2nnc(-c3ccccc3)n2)C1.Cl |
| InChI | InChI=1S/C16H22N6O.ClH/c1-17-10-13-6-5-9-21(11-13)15(23)12-22-19-16(18-20-22)14-7-3-2-4-8-14;/h2-4,7-8,13,17H,5-6,9-12H2,1H3;1H |
| InChIKey | YXLZIWZBVIVUQH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |