C8H12N4O3S — CID 43610496
2-[1-(oxan-4-yl)tetrazol-5-yl]sulfanylacetic acid (PubChem CID 43610496) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-[1-(oxan-4-yl)tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(oxan-4-yl)tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 43610496 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[1-(oxan-4-yl)tetrazol-5-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nnnn1C1CCOCC1 |
| InChI | InChI=1S/C8H12N4O3S/c13-7(14)5-16-8-9-10-11-12(8)6-1-3-15-4-2-6/h6H,1-5H2,(H,13,14) |
| InChIKey | ZEYFHMUOKRGIIS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |