C13H22N4O — CID 43614389
3-amino-N-cycloheptyl-N,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 43614389) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 3-amino-N-cycloheptyl-N,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | 3-amino-N-cycloheptyl-N,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43614389 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-amino-N-cycloheptyl-N,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]nc(N)c1C(=O)N(C)C1CCCCCC1 |
| InChI | InChI=1S/C13H22N4O/c1-9-11(12(14)16-15-9)13(18)17(2)10-7-5-3-4-6-8-10/h10H,3-8H2,1-2H3,(H3,14,15,16) |
| InChIKey | HZPFIWPXNBLPKZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |