C12H20N2O5S — CID 43615525
1-[(1,1-dioxothian-4-yl)carbamoyl]piperidine-4-carboxylic acid (PubChem CID 43615525) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)carbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(1,1-dioxothian-4-yl)carbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 43615525 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)carbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NC2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H20N2O5S/c15-11(16)9-1-5-14(6-2-9)12(17)13-10-3-7-20(18,19)8-4-10/h9-10H,1-8H2,(H,13,17)(H,15,16) |
| InChIKey | KRIVKLZXKNTFRK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |