C12H15F3N2O2S — CID 43617506
N-[4-amino-3-(trifluoromethyl)phenyl]-2-(2-hydroxyethylsulfanyl)propanamide (PubChem CID 43617506) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-(2-hydroxyethylsulfanyl)propanamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-(2-hydroxyethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 43617506 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-(2-hydroxyethylsulfanyl)propanamide |
| SMILES | CC(SCCO)C(=O)Nc1ccc(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-7(20-5-4-18)11(19)17-8-2-3-10(16)9(6-8)12(13,14)15/h2-3,6-7,18H,4-5,16H2,1H3,(H,17,19) |
| InChIKey | RVGUPJMRHRFYOQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|