About 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline
3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline (PubChem CID 43619967) has the molecular formula C12H18N2O3S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline.
Molecular Properties
| Compound Name | 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline |
| PubChem CID | 43619967 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(N)cc1CN1CCCS1(=O)=O |
| InChI | InChI=1S/C12H18N2O3S/c1-2-17-12-5-4-11(13)8-10(12)9-14-6-3-7-18(14,15)16/h4-5,8H,2-3,6-7,9,13H2,1H3 |
| InChIKey | GWOCRJCNMZEZNK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline?
The IUPAC name of 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline (CID 43619967) is 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline.
What is the SMILES notation for 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline?
The canonical SMILES for 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline is CCOc1ccc(N)cc1CN1CCCS1(=O)=O.
What is the InChIKey of 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline?
The InChIKey is GWOCRJCNMZEZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-2-17-12-5-4-11(13)8-10(12)9-14-6-3-7-18(14,15)16/h4-5,8H,2-3,6-7,9,13H2,1H3.
What are the key properties of 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline?
3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline has a molecular weight of 270.35 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-4-ethoxyaniline is sourced from PubChem (CID 43619967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).