C11H16N2O2S — CID 83824828
4-[(1,1-dioxothiazinan-2-yl)methyl]aniline (PubChem CID 83824828) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-[(1,1-dioxothiazinan-2-yl)methyl]aniline.
| Compound Name | 4-[(1,1-dioxothiazinan-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 83824828 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-[(1,1-dioxothiazinan-2-yl)methyl]aniline |
| SMILES | Nc1ccc(CN2CCCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N2O2S/c12-11-5-3-10(4-6-11)9-13-7-1-2-8-16(13,14)15/h3-6H,1-2,7-9,12H2 |
| InChIKey | OELPUKVPPVKFJZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|