C12H16FNO2S — CID 82132335
2-[2-(4-fluorophenyl)ethyl]thiazinane 1,1-dioxide (PubChem CID 82132335) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82132335 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO2S/c13-12-5-3-11(4-6-12)7-9-14-8-1-2-10-17(14,15)16/h3-6H,1-2,7-10H2 |
| InChIKey | DCECGZAJNZIGMX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |