C12H16ClNO2S — CID 94698244
2-[2-(2-chlorophenyl)ethyl]thiazinane 1,1-dioxide (PubChem CID 94698244) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)ethyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[2-(2-chlorophenyl)ethyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 94698244 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[2-(2-chlorophenyl)ethyl]thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1CCc1ccccc1Cl |
| InChI | InChI=1S/C12H16ClNO2S/c13-12-6-2-1-5-11(12)7-9-14-8-3-4-10-17(14,15)16/h1-2,5-6H,3-4,7-10H2 |
| InChIKey | AMYAIZMEAORYKO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |