C14H21NO2S — CID 82134039
2-[2-(2,4-dimethylphenyl)ethyl]thiazinane 1,1-dioxide (PubChem CID 82134039) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)ethyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[2-(2,4-dimethylphenyl)ethyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82134039 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)ethyl]thiazinane 1,1-dioxide |
| SMILES | Cc1ccc(CCN2CCCCS2(=O)=O)c(C)c1 |
| InChI | InChI=1S/C14H21NO2S/c1-12-5-6-14(13(2)11-12)7-9-15-8-3-4-10-18(15,16)17/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | HPQAUGWXLMOTPG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |