C11H14FNO2S — CID 82130195
2-[(4-fluorophenyl)methyl]thiazinane 1,1-dioxide (PubChem CID 82130195) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[(4-fluorophenyl)methyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82130195 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2S/c12-11-5-3-10(4-6-11)9-13-7-1-2-8-16(13,14)15/h3-6H,1-2,7-9H2 |
| InChIKey | MGUAPRUNFKEXLN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |