C10H19N3O3S2 — CID 43620058
N-(3-amino-3-sulfanylidenepropyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-methylpropanamide (PubChem CID 43620058) has the molecular formula C10H19N3O3S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-methylpropanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 43620058 |
| Molecular Formula | C10H19N3O3S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-methylpropanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCN1CCCS1(=O)=O |
| InChI | InChI=1S/C10H19N3O3S2/c1-12(6-3-9(11)17)10(14)4-7-13-5-2-8-18(13,15)16/h2-8H2,1H3,(H2,11,17) |
| InChIKey | MRMLUNHJYZAYSY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|