C15H19BrN4 — CID 43621313
6-bromo-4-N-(1-methylpiperidin-4-yl)quinoline-3,4-diamine (PubChem CID 43621313) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is 6-bromo-4-N-(1-methylpiperidin-4-yl)quinoline-3,4-diamine.
| Compound Name | 6-bromo-4-N-(1-methylpiperidin-4-yl)quinoline-3,4-diamine |
|---|---|
| PubChem CID | 43621313 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 6-bromo-4-N-(1-methylpiperidin-4-yl)quinoline-3,4-diamine |
| SMILES | CN1CCC(Nc2c(N)cnc3ccc(Br)cc23)CC1 |
| InChI | InChI=1S/C15H19BrN4/c1-20-6-4-11(5-7-20)19-15-12-8-10(16)2-3-14(12)18-9-13(15)17/h2-3,8-9,11H,4-7,17H2,1H3,(H,18,19) |
| InChIKey | CQKCKZOSDFAFLR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |