C8H5N3O2S — CID 43622195
2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 43622195) has the molecular formula C8H5N3O2S and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 43622195 |
| Molecular Formula | C8H5N3O2S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2ncccn2)s1 |
| InChI | InChI=1S/C8H5N3O2S/c12-8(13)5-4-11-7(14-5)6-9-2-1-3-10-6/h1-4H,(H,12,13) |
| InChIKey | LRXDMOYYUDZFCC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |