C12H17N3O4 — CID 43623219
methyl 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoate (PubChem CID 43623219) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 43623219 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | methyl 4-methyl-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1c[nH]c(=O)cn1 |
| InChI | InChI=1S/C12H17N3O4/c1-7(2)4-8(12(18)19-3)15-11(17)9-5-14-10(16)6-13-9/h5-8H,4H2,1-3H3,(H,14,16)(H,15,17) |
| InChIKey | RCAOBOPSSOVXSX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |