C13H19N3O5 — CID 43623242
methyl 6-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoate (PubChem CID 43623242) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 6-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 43623242 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | methyl 6-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H19N3O5/c1-21-12(19)5-3-2-4-6-14-10(17)7-9-8-11(18)16-13(20)15-9/h8H,2-7H2,1H3,(H,14,17)(H2,15,16,18,20) |
| InChIKey | ZCDIOPHQCUQLCN-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|