C12H17N3O5 — CID 43469863
2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoic acid (PubChem CID 43469863) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoic acid.
| Compound Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43469863 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)Cc1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C12H17N3O5/c1-2-3-4-8(11(18)19)14-9(16)5-7-6-10(17)15-12(20)13-7/h6,8H,2-5H2,1H3,(H,14,16)(H,18,19)(H2,13,15,17,20) |
| InChIKey | QQPWJVGDHOFFSY-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |