C15H16F3NO — CID 43624682
N-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine (PubChem CID 43624682) has the molecular formula C15H16F3NO and a molecular weight of 283.29 g/mol. Its IUPAC name is N-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43624682 |
| Molecular Formula | C15H16F3NO |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[[5-[2-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2ccccc2C(F)(F)F)o1 |
| InChI | InChI=1S/C15H16F3NO/c1-2-9-19-10-11-7-8-14(20-11)12-5-3-4-6-13(12)15(16,17)18/h3-8,19H,2,9-10H2,1H3 |
| InChIKey | MYKKYYMGDURAPB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|