C15H15BrF3NO — CID 64855525
N-[[5-[4-bromo-3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine (PubChem CID 64855525) has the molecular formula C15H15BrF3NO and a molecular weight of 362.19 g/mol. Its IUPAC name is N-[[5-[4-bromo-3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[4-bromo-3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 64855525 |
| Molecular Formula | C15H15BrF3NO |
| Molecular Weight | 362.19 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[[5-[4-bromo-3-(trifluoromethyl)phenyl]furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2ccc(Br)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C15H15BrF3NO/c1-2-7-20-9-11-4-6-14(21-11)10-3-5-13(16)12(8-10)15(17,18)19/h3-6,8,20H,2,7,9H2,1H3 |
| InChIKey | QJFJVYHJIQZOIZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.19 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|