C14H15BrN2O3 — CID 82864929
N-[[5-(3-bromo-4-nitrophenyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 82864929) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is N-[[5-(3-bromo-4-nitrophenyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(3-bromo-4-nitrophenyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82864929 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | N-[[5-(3-bromo-4-nitrophenyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2ccc([N+](=O)[O-])c(Br)c2)o1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-2-7-16-9-11-4-6-14(20-11)10-3-5-13(17(18)19)12(15)8-10/h3-6,8,16H,2,7,9H2,1H3 |
| InChIKey | ZOKCHMKESZOKBF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|